CAS 113511-22-1
:5-bromo-4-phenyl-1,3-thiazol-2-amine hydrobromide
Description:
5-Bromo-4-phenyl-1,3-thiazol-2-amine hydrobromide is a chemical compound characterized by its thiazole ring structure, which incorporates both sulfur and nitrogen atoms, contributing to its unique reactivity and properties. The presence of a bromine atom at the 5-position and a phenyl group at the 4-position enhances its biological activity and potential applications in medicinal chemistry. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various formulations. This compound may exhibit properties such as antimicrobial or anticancer activity, making it of interest in pharmaceutical research. Its molecular structure allows for interactions with biological targets, potentially influencing enzyme activity or receptor binding. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous. Overall, 5-bromo-4-phenyl-1,3-thiazol-2-amine hydrobromide represents a valuable compound in the field of organic synthesis and drug development.
Formula:C9H8Br2N2S
InChI:InChI=1/C9H7BrN2S.BrH/c10-8-7(12-9(11)13-8)6-4-2-1-3-5-6;/h1-5H,(H2,11,12);1H
SMILES:c1ccc(cc1)c1c(Br)sc(=N)[nH]1.Br
Synonyms:- 5-Bromo-4-Phenyl-Thiazol-2-Amine Hydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
