CymitQuimica logo

CAS 113512-57-5

:

Phenol, 2,4-difluoro-5-nitro-

Description:
Phenol, 2,4-difluoro-5-nitro- (CAS 113512-57-5) is an aromatic compound characterized by the presence of a hydroxyl group (-OH) attached to a benzene ring that is further substituted with two fluorine atoms and a nitro group (-NO2). The fluorine substituents are located at the 2 and 4 positions, while the nitro group is at the 5 position, contributing to the compound's reactivity and potential applications in various chemical processes. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the aromatic ring. The presence of electronegative fluorine and nitro groups enhances the compound's acidity compared to unsubstituted phenol, making it a useful intermediate in organic synthesis and pharmaceuticals. Additionally, the compound's unique electronic properties may influence its behavior in biological systems, warranting further investigation into its toxicity and environmental impact.
Formula:C6H3F2NO3
InChI:InChI=1S/C6H3F2NO3/c7-3-1-4(8)6(10)2-5(3)9(11)12/h1-2,10H
InChI key:SMRYCTJAGPDVEH-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1O)F)F)[N+](=O)[O-]
Synonyms:
  • 2,4-Difluoro-5-Nitro-Phenol
Found 5 products.