CAS 113512-72-4

Phenol, 3-amino-2,4,6-trifluoro-

Description:

Phenol, 3-amino-2,4,6-trifluoro- is an organic compound characterized by the presence of a phenolic hydroxyl group and an amino group, along with three fluorine atoms substituted on the aromatic ring. This compound is a derivative of phenol, where the amino group is located at the meta position relative to the hydroxyl group, and the trifluoromethyl groups are positioned at the 2, 4, and 6 positions of the benzene ring. The presence of fluorine atoms significantly influences the compound's chemical properties, enhancing its reactivity and polarity. It exhibits characteristics typical of both amines and phenols, such as the ability to form hydrogen bonds and participate in electrophilic aromatic substitution reactions. Additionally, the trifluoromethyl groups can impart unique electronic properties, making this compound of interest in various fields, including pharmaceuticals and materials science. Its CAS number, 113512-72-4, allows for precise identification in chemical databases and regulatory contexts. Overall, this compound's unique structure contributes to its potential applications in synthetic chemistry and medicinal chemistry.

Formula: C₆H₄F₃NO

InChI: InChI=1S/C6H4F3NO/c7-2-1-3(8)6(11)4(9)5(2)10/h1,11H,10H2

InChI key: InChIKey=JRJOEUOVPLIHLU-UHFFFAOYSA-N

SMILES: NC1=C(F)C(O)=C(F)C=C1F

Synonyms:

• Phenol, 3-amino-2,4,6-trifluoro-
• 3-Amino-2,4,6-trifluorophenol

3-Amino-2,4,6-Trifluorophenol

CAS: 113512-72-4

Please enquire for more information about 3-Amino-2,4,6-Trifluorophenol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₆H₄F₃NO

Purity: Min. 95%

Molecular weight: 163.1 g/mol

Ref: 3D-FA79279