CAS 113513-30-7

3-Amino-5-[3-(methylamino)propyl]-1H-pyrazole-4-carbonitrile

Description:

3-Amino-5-[3-(methylamino)propyl]-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound features an amino group and a carbonitrile functional group, contributing to its potential reactivity and biological activity. The presence of a propyl chain with a methylamino substituent enhances its solubility and may influence its interaction with biological targets. The molecular structure suggests that it could participate in hydrogen bonding due to the amino and carbonitrile groups, making it a candidate for various applications in medicinal chemistry. Additionally, the compound's unique arrangement of functional groups may impart specific pharmacological properties, potentially making it useful in drug development or as a research tool in biochemistry. Its CAS number, 113513-30-7, allows for easy identification and reference in chemical databases and literature. Overall, this compound exemplifies the complexity and diversity of organic molecules in the realm of chemical research.

Formula: C₈H₁₃N₅

InChI: InChI=1S/C8H13N5/c1-11-4-2-3-7-6(5-9)8(10)13-12-7/h11H,2-4H2,1H3,(H3,10,12,13)

InChI key: InChIKey=FJYUWIMEBHUCPT-UHFFFAOYSA-N

SMILES: C(CCNC)C1=C(C#N)C(N)=NN1

Synonyms:

• 3-Amino-5-[3-(methylamino)propyl]-1H-pyrazole-4-carbonitrile
• 1H-Pyrazole-4-carbonitrile, 3-amino-5-[3-(methylamino)propyl]-