CAS 113515-72-3
:ethyl 4-chloro-8-ethylquinoline-3-carboxylate
Description:
Ethyl 4-chloro-8-ethylquinoline-3-carboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the ethyl group and the chloro substituent on the quinoline ring influences its physical and chemical properties, such as solubility and boiling point. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its synthesis may involve various organic reactions, including esterification and halogenation. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, ethyl 4-chloro-8-ethylquinoline-3-carboxylate represents a class of compounds that can be valuable in research and industrial applications.
Formula:C14H14ClNO2
InChI:InChI=1/C14H14ClNO2/c1-3-9-6-5-7-10-12(15)11(8-16-13(9)10)14(17)18-4-2/h5-8H,3-4H2,1-2H3
Synonyms:- 3-quinolinecarboxylic acid, 4-chloro-8-ethyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Quinolinecarboxylic acid, 4-chloro-8-ethyl-, ethyl ester
CAS:Formula:C14H14ClNO2Molecular weight:263.7195
