CymitQuimica logo

CAS 113515-73-4

:

Ethyl 4-amino-8-ethyl-3-quinolinecarboxylate

Description:
Ethyl 4-amino-8-ethyl-3-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. This substance features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of an amino group at the 4-position and an ethyl group at the 8-position of the quinoline ring indicates potential for various chemical interactions, making it of interest in medicinal chemistry and organic synthesis. The compound may exhibit biological activity, possibly related to its structural motifs, which can influence its pharmacological properties. Additionally, its CAS number, 113515-73-4, allows for precise identification and retrieval of information regarding its properties, safety data, and applications in scientific literature. Overall, Ethyl 4-amino-8-ethyl-3-quinolinecarboxylate represents a versatile compound with potential applications in drug development and chemical research.
Formula:C14H16N2O2
InChI:InChI=1S/C14H16N2O2/c1-3-9-6-5-7-10-12(15)11(8-16-13(9)10)14(17)18-4-2/h5-8H,3-4H2,1-2H3,(H2,15,16)
InChI key:InChIKey=GCOBGJWZSBKCDK-UHFFFAOYSA-N
SMILES:C(C)C=1C2=C(C(N)=C(C(OCC)=O)C=N2)C=CC1
Synonyms:
  • 3-Quinolinecarboxylic acid, 4-amino-8-ethyl-, ethyl ester
  • Ethyl 4-amino-8-ethyl-3-quinolinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.