CAS 113515-74-5

4-Amino-8-ethyl-3-quinolinecarboxylic acid

Description:

4-Amino-8-ethyl-3-quinolinecarboxylic acid is an organic compound characterized by its quinoline structure, which features a bicyclic aromatic system. This compound contains an amino group (-NH2) and a carboxylic acid group (-COOH), contributing to its potential as a biologically active molecule. The presence of the ethyl group at the 8-position of the quinoline ring influences its solubility and reactivity. This compound may exhibit various properties such as moderate to high polarity due to the functional groups, which can engage in hydrogen bonding. Its structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents, as quinoline derivatives are known for their biological activities. Additionally, the compound's stability and reactivity can be influenced by pH and the presence of other functional groups in a reaction environment. Overall, 4-Amino-8-ethyl-3-quinolinecarboxylic acid represents a significant compound in medicinal chemistry, warranting further investigation for its therapeutic potential.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1S/C12H12N2O2/c1-2-7-4-3-5-8-10(13)9(12(15)16)6-14-11(7)8/h3-6H,2H2,1H3,(H2,13,14)(H,15,16)

InChI key: InChIKey=JVCZSNZNCDPRSS-UHFFFAOYSA-N

SMILES: C(C)C=1C2=C(C(N)=C(C(O)=O)C=N2)C=CC1

Synonyms:

• 4-Amino-8-ethyl-3-quinolinecarboxylic acid
• 3-Quinolinecarboxylic acid, 4-amino-8-ethyl-