CAS 113518-48-2
:N-(4-methylphenyl)-2-{[4-phenyl-5-(pyridin-4-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
Description:
N-(4-methylphenyl)-2-{[4-phenyl-5-(pyridin-4-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide, with CAS number 113518-48-2, is a chemical compound characterized by its complex structure, which includes a triazole ring and a sulfanyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the pyridine and triazole moieties suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates it may possess moderate to high lipophilicity, influencing its solubility and permeability. Additionally, the presence of functional groups such as the acetamide and sulfanyl may enhance its reactivity and ability to form hydrogen bonds, which are crucial for biological interactions. Overall, this compound's unique structural features position it as a candidate for further research, particularly in the fields of pharmacology and drug development.
Formula:C22H19N5OS
InChI:InChI=1/C22H19N5OS/c1-16-7-9-18(10-8-16)24-20(28)15-29-22-26-25-21(17-11-13-23-14-12-17)27(22)19-5-3-2-4-6-19/h2-14H,15H2,1H3,(H,24,28)
Synonyms:- acetamide, N-(4-methylphenyl)-2-[[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]-
- N-(4-Methylphenyl)-2-{[4-phenyl-5-(pyridin-4-yl)-4H-1,2,4-triazol-3-yl]sulfanyl}acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.