CAS 113518-53-9
:N-(4-nitrophenyl)-2-[(4-phenyl-5-pyridin-4-yl-4H-1,2,4-triazol-3-yl)sulfanyl]acetamide
Description:
N-(4-nitrophenyl)-2-[(4-phenyl-5-pyridin-4-yl-4H-1,2,4-triazol-3-yl)sulfanyl]acetamide, with CAS number 113518-53-9, is a chemical compound characterized by its complex structure, which includes a nitrophenyl group, a triazole moiety, and a sulfanyl linkage. This compound is typically classified as an organic molecule and may exhibit properties such as moderate to high solubility in organic solvents, depending on the specific functional groups present. The presence of the nitro group suggests potential for biological activity, possibly as an antimicrobial or antifungal agent, while the triazole ring is often associated with pharmacological properties. The compound's molecular interactions may be influenced by hydrogen bonding and π-π stacking due to its aromatic components. Additionally, its synthesis and stability can be affected by the conditions under which it is prepared, including temperature and pH. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry and material science.
Formula:C21H16N6O3S
InChI:InChI=1/C21H16N6O3S/c28-19(23-16-6-8-18(9-7-16)27(29)30)14-31-21-25-24-20(15-10-12-22-13-11-15)26(21)17-4-2-1-3-5-17/h1-13H,14H2,(H,23,28)
Synonyms:- acetamide, N-(4-nitrophenyl)-2-[[4-phenyl-5-(4-pyridinyl)-4H-1,2,4-triazol-3-yl]thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.