
CAS 113520-20-0
:2-morpholinooxazolo[4,5-b]pyridine
Description:
2-Morpholinooxazolo[4,5-b]pyridine is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both an oxazole and a pyridine ring, along with a morpholine substituent. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in polar solvents. The presence of the morpholino group may enhance its ability to interact with biological targets, making it of interest in medicinal chemistry. Additionally, the oxazole and pyridine rings contribute to its electronic properties, potentially influencing its reactivity and stability. The compound may also display fluorescence or other optical properties, depending on its specific structure and substituents. Its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and chemical reactivity. As with many heterocycles, the synthesis and characterization of 2-morpholinooxazolo[4,5-b]pyridine would involve various analytical techniques to confirm its structure and purity.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c1-2-8-9(11-3-1)12-10(15-8)13-4-6-14-7-5-13/h1-3H,4-7H2
InChI key:VKZARXNIZDHSLC-UHFFFAOYSA-N
SMILES:C1COCCN1C2=NC3=C(O2)C=CC=N3
Synonyms:- 2-morpholinooxazolo[4,5-b]pyridine
- Oxazolo[4,5-b]pyridine, 2-(4-morpholinyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery