CAS 1135282-86-8

Ethyl 2-amino-4-methoxy-5-methylbenzoate

Description:

Ethyl 2-amino-4-methoxy-5-methylbenzoate, with the CAS number 1135282-86-8, is an organic compound characterized by its ester functional group and an aromatic ring. This compound features an ethyl ester derived from 2-amino-4-methoxy-5-methylbenzoic acid, indicating the presence of an amino group (-NH2), a methoxy group (-OCH3), and a methyl group (-CH3) on the benzene ring. The presence of these functional groups contributes to its potential biological activity and solubility properties. Ethyl 2-amino-4-methoxy-5-methylbenzoate may exhibit moderate polarity due to the combination of hydrophilic (amino and methoxy) and hydrophobic (methyl and ethyl) groups. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with analgesic or anti-inflammatory properties. Additionally, the compound's stability and reactivity can be influenced by the substituents on the aromatic ring, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1S/C11H15NO3/c1-4-15-11(13)8-5-7(2)10(14-3)6-9(8)12/h5-6H,4,12H2,1-3H3

InChI key: InChIKey=DHCQOODDCXZLKZ-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(N)C=C(OC)C(C)=C1

Synonyms:

• Ethyl 2-amino-4-methoxy-5-methylbenzoate
• Benzoic acid, 2-amino-4-methoxy-5-methyl-, ethyl ester