CAS 1135282-87-9

3-(5-Nitro-2-benzofuranyl)-2-propenoic acid

Description:

3-(5-Nitro-2-benzofuranyl)-2-propenoic acid, identified by its CAS number 1135282-87-9, is an organic compound characterized by its unique structure that includes a benzofuran moiety and a propenoic acid functional group. This compound typically exhibits properties associated with both aromatic and unsaturated carboxylic acids, such as potential reactivity in electrophilic substitution and conjugate addition reactions. The presence of the nitro group enhances its electrophilic character, making it a candidate for various chemical transformations. It may also display biological activity, which is common for compounds containing both aromatic systems and carboxylic acid functionalities. The compound's solubility, stability, and reactivity can be influenced by the presence of the nitro group and the overall molecular structure. As with many organic compounds, its behavior in different solvents and under varying conditions can provide insights into its potential applications in pharmaceuticals, agrochemicals, or materials science. Further studies would be necessary to fully elucidate its properties and potential uses.

Formula: C₁₁H₇NO₅

InChI: InChI=1S/C11H7NO5/c13-11(14)4-2-9-6-7-5-8(12(15)16)1-3-10(7)17-9/h1-6H,(H,13,14)

InChI key: InChIKey=JMNMWGHQIABWLM-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C2C(OC(C=CC(O)=O)=C2)=CC1

Synonyms:

• 2-Propenoic acid, 3-(5-nitro-2-benzofuranyl)-
• 3-(5-Nitro-2-benzofuranyl)-2-propenoic acid