CAS 1135282-96-0

2-Chloro-4-(1-piperidinyl)benzenemethanol

Description:

2-Chloro-4-(1-piperidinyl)benzenemethanol is an organic compound characterized by its aromatic structure, which includes a chlorinated benzene ring and a piperidine moiety. The presence of the chlorine atom at the para position relative to the hydroxymethyl group contributes to its reactivity and potential biological activity. The piperidine ring, a six-membered nitrogen-containing heterocycle, enhances the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxymethyl group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions. Additionally, the compound's properties, such as melting point, boiling point, and specific reactivity, would depend on its purity and the presence of functional groups. Safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₁₂H₁₆ClNO

InChI: InChI=1S/C12H16ClNO/c13-12-8-11(5-4-10(12)9-15)14-6-2-1-3-7-14/h4-5,8,15H,1-3,6-7,9H2

InChI key: InChIKey=PDOLNWXZPRYAKL-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1CO)N2CCCCC2

Synonyms:

• 2-Chloro-4-(1-piperidinyl)benzenemethanol
• Benzenemethanol, 2-chloro-4-(1-piperidinyl)-
• (2-Chloro-4-piperidin-1-ylphenyl)methanol
• (2-Chloro-4-piperidinophenyl)methanol

[2-Chloro-4-(piperidin-1-yl)phenyl]methanol

CAS: 1135282-96-0

[2-Chloro-4-(piperidin-1-yl)phenyl]methanol

Purity: 95%

Molecular weight: 225.71g/mol

Ref: 54-OR33484