CymitQuimica logo

CAS 1135282-97-1

:

N-(2-Fluoro-5-nitrophenyl)-N-(methylsulfonyl)methanesulfonamide

Description:
N-(2-Fluoro-5-nitrophenyl)-N-(methylsulfonyl)methanesulfonamide is a chemical compound characterized by its complex structure, which includes a fluorinated aromatic ring and sulfonamide functional groups. The presence of a nitro group on the phenyl ring contributes to its electron-withdrawing properties, potentially influencing its reactivity and interactions in biological systems. The methylsulfonyl group enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. This compound may exhibit specific biological activities due to its unique functional groups, which can interact with biological targets. Additionally, the fluorine atom can affect the compound's lipophilicity and metabolic stability. Overall, the combination of these features suggests that N-(2-Fluoro-5-nitrophenyl)-N-(methylsulfonyl)methanesulfonamide could be of interest in the development of pharmaceuticals or agrochemicals, although specific biological activities and applications would require further investigation.
Formula:C8H9FN2O6S2
InChI:InChI=1S/C8H9FN2O6S2/c1-18(14,15)11(19(2,16)17)8-5-6(10(12)13)3-4-7(8)9/h3-5H,1-2H3
InChI key:InChIKey=FMNCWLZUNMZSGW-UHFFFAOYSA-N
SMILES:N(S(C)(=O)=O)(S(C)(=O)=O)C1=CC(N(=O)=O)=CC=C1F
Synonyms:
  • Methanesulfonamide, N-(2-fluoro-5-nitrophenyl)-N-(methylsulfonyl)-
  • N-(2-Fluoro-5-nitrophenyl)-N-(methylsulfonyl)methanesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.