
CAS 1135283-00-9
:Methyl 1-methyl-4-(1-oxopropyl)-1H-pyrrole-2-carboxylate
Description:
Methyl 1-methyl-4-(1-oxopropyl)-1H-pyrrole-2-carboxylate is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a methyl group and a carboxylate ester functional group, contributing to its reactivity and solubility properties. The presence of the 1-oxopropyl substituent indicates that it has a ketone functional group, which can participate in various chemical reactions, such as nucleophilic additions. The compound's molecular structure suggests it may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility in organic solvents and potential for forming hydrogen bonds can influence its interactions in biological systems. As with many pyrrole derivatives, it may also display interesting electronic properties due to the conjugated system within the ring. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C10H13NO3
InChI:InChI=1S/C10H13NO3/c1-4-9(12)7-5-8(10(13)14-3)11(2)6-7/h5-6H,4H2,1-3H3
InChI key:InChIKey=XFRSMPAXGYJFGB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CC(C(CC)=O)=CN1C
Synonyms:- Methyl 1-methyl-4-(1-oxopropyl)-1H-pyrrole-2-carboxylate
- 1H-Pyrrole-2-carboxylic acid, 1-methyl-4-(1-oxopropyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.