CAS 1135283-30-5: 6-Bromo-3-(2,2,2-trifluoroethyl)-4(3H)-quinazolinone
Description:6-Bromo-3-(2,2,2-trifluoroethyl)-4(3H)-quinazolinone is a synthetic organic compound characterized by its quinazolinone core structure, which is a bicyclic compound containing both a benzene and a pyrimidine ring. The presence of a bromine atom at the 6-position and a trifluoroethyl group at the 3-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its trifluoroethyl group can enhance metabolic stability and influence interactions with biological targets. The compound is likely to be solid at room temperature and may have moderate solubility in organic solvents. As with many halogenated compounds, it may also exhibit specific reactivity patterns, particularly in nucleophilic substitution reactions. Safety and handling precautions should be observed due to the presence of bromine and fluorine, which can pose health and environmental risks. Further studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C10H6BrF3N2O
InChI:InChI=1S/C10H6BrF3N2O/c11-6-1-2-8-7(3-6)9(17)16(5-15-8)4-10(12,13)14/h1-3,5H,4H2
InChI key:InChIKey=QFZOSUVYVRLTRW-UHFFFAOYSA-N
SMILES:O=C1C=2C=C(Br)C=CC2N=CN1CC(F)(F)F
- Synonyms:
- 4(3H)-Quinazolinone, 6-bromo-3-(2,2,2-trifluoroethyl)-
- 6-Bromo-3-(2,2,2-trifluoroethyl)-4(3H)-quinazolinone
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 6-Bromo-3-(2,2,2-trifluoroethyl)quinazolin-4(3H)-one REF: 54-PC200214CAS: 1135283-30-5 | - - - | 482.00 €~727.00 € | Mon 03 Mar 25 |
 | 6-Bromo-3-(2,2,2-trifluoroethyl)quinazolin-4(3H)-one REF: 10-F728302CAS: 1135283-30-5 | 95+% | - - - | Discontinued product |
 | 6-Bromo-3-(2,2,2-trifluoroethyl)quinazolin-4(3H)-one REF: 3D-KVB28330CAS: 1135283-30-5 | Min. 95% | - - - | Discontinued product |
Ref: 54-PC200214
| 1g | 727.00 € | ||
| 500mg | 482.00 € |
6-Bromo-3-(2,2,2-trifluoroethyl)quinazolin-4(3H)-one
Ref: 10-F728302
| 1g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
6-Bromo-3-(2,2,2-trifluoroethyl)quinazolin-4(3H)-one
Ref: 3D-KVB28330
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
