CAS 1135283-35-0

Ethyl 5-[[(1,1-dimethylethoxy)carbonyl]amino]-2-benzofurancarboxylate

Description:

Ethyl 5-[[(1,1-dimethylethoxy)carbonyl]amino]-2-benzofurancarboxylate is a chemical compound characterized by its complex structure, which includes a benzofuran moiety and an ethyl ester functional group. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it has a bulky protective group, which can influence its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic benzofuran and polar ester functionalities. It may participate in various chemical reactions, including nucleophilic substitutions and hydrolysis, depending on the conditions. The compound's potential applications could span across pharmaceuticals and agrochemicals, particularly in the synthesis of biologically active molecules. Additionally, its stability and reactivity can be influenced by factors such as pH and temperature. Overall, this compound represents a unique structure that may be of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₆H₁₉NO₅

InChI: InChI=1S/C16H19NO5/c1-5-20-14(18)13-9-10-8-11(6-7-12(10)21-13)17-15(19)22-16(2,3)4/h6-9H,5H2,1-4H3,(H,17,19)

InChI key: InChIKey=GCEPJGJODYXZTA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1OC=2C(C1)=CC(NC(OC(C)(C)C)=O)=CC2

Synonyms:

• Ethyl 5-[[(1,1-dimethylethoxy)carbonyl]amino]-2-benzofurancarboxylate
• 2-Benzofurancarboxylic acid, 5-[[(1,1-dimethylethoxy)carbonyl]amino]-, ethyl ester