CAS 1135283-46-3

1,1-Dimethylethyl 2-[(4-bromo-2-fluorophenyl)methylene]hydrazinecarboxylate

Description:

1,1-Dimethylethyl 2-[(4-bromo-2-fluorophenyl)methylene]hydrazinecarboxylate, identified by its CAS number 1135283-46-3, is a chemical compound that features a hydrazinecarboxylate functional group, which is significant in various chemical reactions, particularly in organic synthesis. The presence of a 4-bromo-2-fluorophenyl group indicates that the compound has halogen substituents, which can influence its reactivity and biological activity. The dimethyl group contributes to steric hindrance, potentially affecting the compound's interaction with other molecules. This compound may exhibit properties typical of hydrazine derivatives, such as potential reactivity with electrophiles and the ability to form stable complexes. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. However, specific characteristics such as solubility, melting point, and stability would require empirical data for precise evaluation. As with many chemical substances, safety and handling precautions are essential due to the presence of halogens and the potential for reactivity.

Formula: C₁₂H₁₄BrFN₂O₂

InChI: InChI=1S/C12H14BrFN2O2/c1-12(2,3)18-11(17)16-15-7-8-4-5-9(13)6-10(8)14/h4-7H,1-3H3,(H,16,17)

InChI key: InChIKey=UWPLZOFFMZJGKF-UHFFFAOYSA-N

SMILES: C(=NNC(OC(C)(C)C)=O)C1=C(F)C=C(Br)C=C1

Synonyms:

• Hydrazinecarboxylic acid, 2-[(4-bromo-2-fluorophenyl)methylene]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 2-[(4-bromo-2-fluorophenyl)methylene]hydrazinecarboxylate