
CAS 1135283-51-0
:1,1-Dimethylethyl 4-(4-cyano-2-pyrimidinyl)-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 4-(4-cyano-2-pyrimidinyl)-1-piperazinecarboxylate, identified by its CAS number 1135283-51-0, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyrimidine moiety. This substance typically exhibits properties associated with both heterocyclic compounds and carboxylates, such as moderate solubility in polar solvents and potential biological activity due to its piperazine and pyrimidine components. The presence of the cyano group suggests potential reactivity and the ability to participate in various chemical reactions, including nucleophilic additions. Additionally, the tert-butyl group (1,1-dimethylethyl) may influence the compound's lipophilicity and steric hindrance, affecting its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly for its potential pharmacological properties. However, specific applications and biological activities would require further investigation and empirical studies.
Formula:C14H19N5O2
InChI:InChI=1S/C14H19N5O2/c1-14(2,3)21-13(20)19-8-6-18(7-9-19)12-16-5-4-11(10-15)17-12/h4-5H,6-9H2,1-3H3
InChI key:InChIKey=AAUXQCMFMNQGDG-UHFFFAOYSA-N
SMILES:C(#N)C1=NC(=NC=C1)N2CCN(C(OC(C)(C)C)=O)CC2
Synonyms:- 1-Piperazinecarboxylic acid, 4-(4-cyano-2-pyrimidinyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-(4-cyano-2-pyrimidinyl)-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.