CAS 1135283-54-3

2-(1-Piperazinyl)-4-pyrimidinecarbonitrile

Description:

2-(1-Piperazinyl)-4-pyrimidinecarbonitrile is a chemical compound characterized by its piperazine and pyrimidine moieties, which contribute to its biological activity and potential pharmacological applications. The presence of the carbonitrile functional group enhances its reactivity and solubility in various solvents. This compound typically exhibits properties such as moderate to high polarity due to the nitrogen atoms in both the piperazine and pyrimidine rings, which can engage in hydrogen bonding. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 2-(1-Piperazinyl)-4-pyrimidinecarbonitrile represents a versatile scaffold for further chemical modifications and investigations in drug discovery.

Formula: C₉H₁₁N₅

InChI: InChI=1S/C9H11N5/c10-7-8-1-2-12-9(13-8)14-5-3-11-4-6-14/h1-2,11H,3-6H2

InChI key: InChIKey=GCSQTXKOGMEAGM-UHFFFAOYSA-N

SMILES: C(#N)C1=NC(=NC=C1)N2CCNCC2

Synonyms:

• 2-Piperazino-4-pyrimidinecarbonitrile
• 4-Pyrimidinecarbonitrile, 2-(1-piperazinyl)-
• 2-(1-Piperazinyl)-4-pyrimidinecarbonitrile