CAS 1135283-55-4

1,1-Dimethylethyl 4-[3-(methoxycarbonyl)-4-nitrophenyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[3-(methoxycarbonyl)-4-nitrophenyl]-1-piperazinecarboxylate, identified by its CAS number 1135283-55-4, is a chemical compound characterized by its complex structure, which includes a piperazine ring, a nitrophenyl group, and a methoxycarbonyl substituent. This compound typically exhibits properties associated with both piperazine derivatives and nitrophenyl compounds, such as potential biological activity and solubility in organic solvents. The presence of the dimethyl group contributes to its steric hindrance, which can influence its reactivity and interaction with biological targets. Additionally, the nitro group may impart specific electronic properties, making it a candidate for various applications in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would be of interest for pharmacological studies. Overall, this compound represents a unique combination of functional groups that could lead to diverse applications in research and industry.

Formula: C₁₇H₂₃N₃O₆

InChI: InChI=1S/C17H23N3O6/c1-17(2,3)26-16(22)19-9-7-18(8-10-19)12-5-6-14(20(23)24)13(11-12)15(21)25-4/h5-6,11H,7-10H2,1-4H3

InChI key: InChIKey=IEIYBNLJOYSSGO-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=CC1N(=O)=O)N2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 1-Piperazinecarboxylic acid, 4-[3-(methoxycarbonyl)-4-nitrophenyl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-[3-(methoxycarbonyl)-4-nitrophenyl]-1-piperazinecarboxylate
• tert-butyl 4-(3-methoxycarbonyl-4-nitrophenyl)piperazine-1-carboxylate
• tert-butyl 4-[3-(methoxycarbonyl)-4-nitrophenyl]tetrahydro-1(2H)-pyrazinecarboxylate