CymitQuimica logo

CAS 1135283-60-1

:

1,1-Dimethylethyl 2-(4-aminobenzoyl)tetrahydro-1(2H)-pyridazinecarboxylate

Description:
1,1-Dimethylethyl 2-(4-aminobenzoyl)tetrahydro-1(2H)-pyridazinecarboxylate, identified by its CAS number 1135283-60-1, is a chemical compound that features a complex structure incorporating a tetrahydropyridazine ring and an amine-substituted benzoyl group. This compound is characterized by its potential biological activity, which may include interactions with various biological targets due to the presence of the amine and carboxylate functional groups. The dimethyl substituents contribute to its steric properties, potentially influencing its solubility and reactivity. As a member of the pyridazine family, it may exhibit unique chemical behaviors, such as forming hydrogen bonds or participating in electrophilic reactions. The compound's stability, solubility, and reactivity can be influenced by the surrounding functional groups and the overall molecular conformation. While specific applications or biological activities may not be widely documented, compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Further research would be necessary to elucidate its specific properties and applications.
Formula:C16H23N3O3
InChI:InChI=1S/C16H23N3O3/c1-16(2,3)22-15(21)19-11-5-4-10-18(19)14(20)12-6-8-13(17)9-7-12/h6-9H,4-5,10-11,17H2,1-3H3
InChI key:InChIKey=MVYMRAPMCNWZIR-UHFFFAOYSA-N
SMILES:C(=O)(N1N(C(OC(C)(C)C)=O)CCCC1)C2=CC=C(N)C=C2
Synonyms:
  • 1,1-Dimethylethyl 2-(4-aminobenzoyl)tetrahydro-1(2H)-pyridazinecarboxylate
  • 1(2H)-Pyridazinecarboxylic acid, 2-(4-aminobenzoyl)tetrahydro-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.