CAS 1135283-65-6
:4-(2,6-Dimethyl-4-morpholinyl)-2-methoxybenzenamine
Description:
4-(2,6-Dimethyl-4-morpholinyl)-2-methoxybenzenamine, identified by its CAS number 1135283-65-6, is an organic compound characterized by its complex structure, which includes a methoxy group and a morpholine ring. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate polarity due to the presence of both hydrophobic and hydrophilic functional groups. The dimethyl substitution on the morpholine ring can influence its steric and electronic properties, potentially affecting its reactivity and interactions with biological systems. Additionally, the methoxy group can enhance the compound's lipophilicity, which may impact its pharmacokinetic profile if considered for medicinal applications. Overall, this compound's unique structural features suggest it may have specific applications in pharmaceuticals or materials science, although further studies would be necessary to fully elucidate its behavior and potential uses in various chemical contexts.
Formula:C13H20N2O2
InChI:InChI=1S/C13H20N2O2/c1-9-7-15(8-10(2)17-9)11-4-5-12(14)13(6-11)16-3/h4-6,9-10H,7-8,14H2,1-3H3
InChI key:InChIKey=OQMDAGZSLXKJAG-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1N)N2CC(C)OC(C)C2
Synonyms:- Benzenamine, 4-(2,6-dimethyl-4-morpholinyl)-2-methoxy-
- 4-(2,6-Dimethyl-4-morpholinyl)-2-methoxybenzenamine
- 4-(2,6-Dimethylmorpholino)-2-methoxyaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.