CAS 1135283-72-5

1,1-Dimethylethyl 4-[2-(3-aminophenoxy)ethyl]-1-piperazinecarboxylate

Description:

1,1-Dimethylethyl 4-[2-(3-aminophenoxy)ethyl]-1-piperazinecarboxylate, identified by its CAS number 1135283-72-5, is a chemical compound characterized by its complex structure, which includes a piperazine ring and an amino phenoxy group. This compound typically exhibits properties associated with both amines and esters, suggesting potential solubility in polar solvents and moderate lipophilicity. The presence of the piperazine moiety may impart basic characteristics, allowing it to interact with biological systems, potentially influencing pharmacological activity. Additionally, the dimethyl groups contribute to steric hindrance, which can affect the compound's reactivity and interaction with biological targets. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. As with many organic compounds, safety and handling precautions are essential, as they may pose risks such as irritation or toxicity depending on exposure levels. Further studies would be necessary to elucidate its full chemical behavior and potential applications.

Formula: C₁₇H₂₇N₃O₃

InChI: InChI=1S/C17H27N3O3/c1-17(2,3)23-16(21)20-9-7-19(8-10-20)11-12-22-15-6-4-5-14(18)13-15/h4-6,13H,7-12,18H2,1-3H3

InChI key: InChIKey=MLXGEAQWQODNJK-UHFFFAOYSA-N

SMILES: C(COC1=CC(N)=CC=C1)N2CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• 4-[2-(3-Amino-phenoxy)-ethyl]piperazine-1-carboxylic acid tert-butyl ester
• 1,1-Dimethylethyl 4-[2-(3-aminophenoxy)ethyl]-1-piperazinecarboxylate
• 1-Piperazinecarboxylic acid, 4-[2-(3-aminophenoxy)ethyl]-, 1,1-dimethylethyl ester