
CAS 1135283-73-6
:Methyl 5-(methylamino)-2-nitrobenzoate
Description:
Methyl 5-(methylamino)-2-nitrobenzoate, identified by its CAS number 1135283-73-6, is an organic compound that belongs to the class of benzoate esters. This substance features a methyl group and a nitro group attached to a benzoate ring, along with a methylamino substituent, which contributes to its chemical reactivity and properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents due to their hydrophobic aromatic structure, while their polar functional groups can influence their interactions with polar solvents. The presence of the nitro group often imparts additional reactivity, making it a potential candidate for further chemical transformations. Methyl 5-(methylamino)-2-nitrobenzoate may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthetic applications. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards.
Formula:C9H10N2O4
InChI:InChI=1S/C9H10N2O4/c1-10-6-3-4-8(11(13)14)7(5-6)9(12)15-2/h3-5,10H,1-2H3
InChI key:InChIKey=PBMGKPKKYDPJMG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N(=O)=O)C=CC(NC)=C1
Synonyms:- Benzoic acid, 5-(methylamino)-2-nitro-, methyl ester
- Methyl 5-(methylamino)-2-nitrobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.