CymitQuimica logo

CAS 1135283-80-5

:

3-Bromo-4-[(3,5-dimethylphenyl)methoxy]benzaldehyde

Description:
3-Bromo-4-[(3,5-dimethylphenyl)methoxy]benzaldehyde is an organic compound characterized by its complex structure, which includes a bromine atom, a methoxy group, and an aldehyde functional group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties, affecting reactivity and stability. The 3,5-dimethylphenyl moiety contributes to the compound's hydrophobic characteristics and steric bulk, which can impact its interactions with other molecules. This compound may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its unique functional groups that allow for further derivatization. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Overall, 3-Bromo-4-[(3,5-dimethylphenyl)methoxy]benzaldehyde is a versatile compound with potential applications in various fields of chemical research.
Formula:C16H15BrO2
InChI:InChI=1S/C16H15BrO2/c1-11-5-12(2)7-14(6-11)10-19-16-4-3-13(9-18)8-15(16)17/h3-9H,10H2,1-2H3
InChI key:InChIKey=LHVKCVQGCPZCMR-UHFFFAOYSA-N
SMILES:C(OC1=C(Br)C=C(C=O)C=C1)C2=CC(C)=CC(C)=C2
Synonyms:
  • 3-Bromo-4-[(3,5-dimethylphenyl)methoxy]benzaldehyde
  • Benzaldehyde, 3-bromo-4-[(3,5-dimethylphenyl)methoxy]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.