CAS 1135283-84-9
:1,1-Dimethylethyl 4-(3-cyano-6-cyclopropyl-2-pyridinyl)-1-piperazinecarboxylate
Description:
1,1-Dimethylethyl 4-(3-cyano-6-cyclopropyl-2-pyridinyl)-1-piperazinecarboxylate, identified by its CAS number 1135283-84-9, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic compound containing two nitrogen atoms. The presence of a cyano group and a cyclopropyl moiety suggests potential reactivity and biological activity, making it of interest in medicinal chemistry. The dimethyl group attached to the piperazine enhances lipophilicity, potentially influencing its pharmacokinetic properties. The compound's structure indicates it may interact with various biological targets, possibly exhibiting activity as a pharmaceutical agent. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties, such as solubility, stability, and reactivity, would be essential for understanding its potential applications. Further studies would be necessary to elucidate its biological effects and therapeutic potential.
Formula:C18H24N4O2
InChI:InChI=1S/C18H24N4O2/c1-18(2,3)24-17(23)22-10-8-21(9-11-22)16-14(12-19)6-7-15(20-16)13-4-5-13/h6-7,13H,4-5,8-11H2,1-3H3
InChI key:InChIKey=KXHIRDUGFMXLKB-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N=C(C=C1)C2CC2)N3CCN(C(OC(C)(C)C)=O)CC3
Synonyms:- 1-Piperazinecarboxylic acid, 4-(3-cyano-6-cyclopropyl-2-pyridinyl)-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 4-(3-cyano-6-cyclopropyl-2-pyridinyl)-1-piperazinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 4-(3-cyano-6-cyclopropyl-2-pyridinyl)tetrahydro-1(2H)-pyrazinecarboxylate
CAS:tert-Butyl 4-(3-cyano-6-cyclopropyl-2-pyridinyl)tetrahydro-1(2H)-pyrazinecarboxylate
Molecular weight:328.41g/mol
