CAS 1135288-85-5

Benzenepropanamide, 3-amino-N,N-dimethyl-, hydrochloride (1:1)

Description:

Benzenepropanamide, 3-amino-N,N-dimethyl-, hydrochloride (1:1), with the CAS number 1135288-85-5, is a chemical compound characterized by its amide functional group and a benzene ring structure. This compound features a dimethylamino group, which contributes to its basicity and potential solubility in polar solvents. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its stability and solubility in aqueous solutions. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The presence of the amino group suggests potential for hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the molecular structure implies that it may participate in various chemical reactions, including nucleophilic substitutions or acylations. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory or industrial settings. Overall, this compound's unique structural features position it as a candidate for further study in medicinal chemistry and related fields.

Formula: C₁₁H₁₆N₂O·ClH

InChI: InChI=1S/C11H16N2O.ClH/c1-13(2)11(14)7-6-9-4-3-5-10(12)8-9;/h3-5,8H,6-7,12H2,1-2H3;1H

InChI key: InChIKey=HEOBCONXLLWHIE-UHFFFAOYSA-N

SMILES: C(CC(N(C)C)=O)C1=CC(N)=CC=C1.Cl

Synonyms:

• Benzenepropanamide, 3-amino-N,N-dimethyl-, hydrochloride (1:1)