CAS 1135324-02-5

5-Cyclopropyl-1-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxylic acid

Description:

5-Cyclopropyl-1-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a cyclopropyl group, and a trifluoromethyl-substituted phenyl moiety. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it of interest in various chemical applications. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the trifluoromethyl group often enhances lipophilicity and biological activity. The cyclopropyl group may contribute to the compound's conformational rigidity, potentially influencing its reactivity and interactions with biological targets. Additionally, the trifluoromethyl group is known to impart unique electronic properties, which can affect the compound's overall stability and reactivity. Overall, this compound's distinctive structure and functional groups make it a candidate for research in medicinal chemistry and material science, particularly in the development of pharmaceuticals or agrochemicals.

Formula: C₁₄H₁₁F₃N₂O₂

InChI: InChI=1S/C14H11F3N2O2/c15-14(16,17)9-2-1-3-10(6-9)19-12(8-4-5-8)11(7-18-19)13(20)21/h1-3,6-8H,4-5H2,(H,20,21)

InChI key: InChIKey=SDGJRHPZWDXGLB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N(N=C1)C2=CC(C(F)(F)F)=CC=C2)C3CC3

Synonyms:

• 5-Cyclopropyl-1-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 5-cyclopropyl-1-[3-(trifluoromethyl)phenyl]-