CAS 1135324-04-7

5-(1-Methylethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]-1H-pyrazole-4-carboxylic acid

Description:

5-(1-Methylethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a pyridine moiety, along with a carboxylic acid functional group. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is typically used in pharmaceutical research and development, particularly in the context of drug discovery, due to its potential as a bioactive molecule. Its unique structural features may contribute to specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety and handling precautions are essential when working with this substance, as with many chemical compounds, to mitigate any potential hazards associated with its use. Overall, this compound exemplifies the intricate design often found in modern synthetic organic chemistry aimed at developing new therapeutic agents.

Formula: C₁₃H₁₂F₃N₃O₂

InChI: InChI=1S/C13H12F3N3O2/c1-7(2)11-9(12(20)21)6-18-19(11)10-4-3-8(5-17-10)13(14,15)16/h3-7H,1-2H3,(H,20,21)

InChI key: InChIKey=ISKOPZKUFDFACS-UHFFFAOYSA-N

SMILES: C(C)(C)C=1N(N=CC1C(O)=O)C2=CC=C(C(F)(F)F)C=N2

Synonyms:

• 5-Isopropyl-1-[5-(trifluoromethyl)pyridin-2-yl]-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 5-(1-methylethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]-
• 5-(1-Methylethyl)-1-[5-(trifluoromethyl)-2-pyridinyl]-1H-pyrazole-4-carboxylic acid