CAS 1135324-06-9

5-Ethyl-1-(2-pyridinyl)-1H-pyrazole-4-carboxylic acid

Description:

5-Ethyl-1-(2-pyridinyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with an ethyl group and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as moderate solubility in polar solvents and potential for forming hydrogen bonds due to the presence of the carboxylic acid functional group. The presence of the pyridine ring may contribute to its basicity and potential interactions in biological systems. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various chemical reactions, including esterification and amidation, which can be utilized in synthetic applications. Overall, 5-Ethyl-1-(2-pyridinyl)-1H-pyrazole-4-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₁₁H₁₁N₃O₂

InChI: InChI=1S/C11H11N3O2/c1-2-9-8(11(15)16)7-13-14(9)10-5-3-4-6-12-10/h3-7H,2H2,1H3,(H,15,16)

InChI key: InChIKey=YGUYAMAJYZDTGO-UHFFFAOYSA-N

SMILES: C(C)C=1N(N=CC1C(O)=O)C2=CC=CC=N2

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 5-ethyl-1-(2-pyridinyl)-
• 5-Ethyl-1-(2-pyridinyl)-1H-pyrazole-4-carboxylic acid