CymitQuimica logo

CAS 113534-02-4

:

1-Piperazinecarboxylic acid, 4-cyano-, 1,1-dimethylethyl ester

Description:
1-Piperazinecarboxylic acid, 4-cyano-, 1,1-dimethylethyl ester, identified by CAS number 113534-02-4, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a cyano group (-CN) at the 4-position of the piperazine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the 1,1-dimethylethyl ester group indicates that it has an ester functional group, which can influence its solubility and stability. Generally, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential for various chemical reactions, including hydrolysis and nucleophilic substitutions. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by the functional groups present and the overall molecular architecture. As with many piperazine derivatives, it may also possess specific pharmacological properties, warranting further investigation for potential therapeutic applications.
Formula:C10H17N3O2
InChI:InChI=1S/C10H17N3O2/c1-10(2,3)15-9(14)13-6-4-12(8-11)5-7-13/h4-7H2,1-3H3
InChI key:GDPSCFYDXPEIEE-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)C#N
Found 6 products.