CAS 113534-16-0
:N(alpha)-fmoc-N(gamma)-(4,4'-dimethoxy-benzhydryl)-L-aspara
Description:
N(alpha)-Fmoc-N(gamma)-(4,4'-dimethoxy-benzhydryl)-L-asparagine is a derivative of the amino acid L-asparagine, modified with a fluorenylmethoxycarbonyl (Fmoc) protecting group and a benzhydryl moiety. The Fmoc group is commonly used in peptide synthesis as a protective group for the amino group, allowing for selective reactions at the carboxyl end. The presence of the 4,4'-dimethoxy-benzhydryl group enhances the compound's hydrophobicity and steric bulk, which can influence its solubility and reactivity. This compound is typically utilized in the field of peptide chemistry, particularly in solid-phase peptide synthesis, where the protection and deprotection of functional groups are crucial for the successful assembly of peptides. Its structural characteristics suggest potential applications in drug development and biochemistry, where modifications to amino acids can lead to novel therapeutic agents. As with many synthetic compounds, careful handling and characterization are essential to ensure purity and efficacy in research applications.
Formula:C34H32N2O7
InChI:InChI=1/C34H32N2O7/c1-41-23-15-11-21(12-16-23)32(22-13-17-24(42-2)18-14-22)36-31(37)19-30(33(38)39)35-34(40)43-20-29-27-9-5-3-7-25(27)26-8-4-6-10-28(26)29/h3-18,29-30,32H,19-20H2,1-2H3,(H,35,40)(H,36,37)(H,38,39)/t30-/m0/s1
SMILES:COc1ccc(cc1)C(c1ccc(cc1)OC)N=C(C[C@@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12)O
Synonyms:- Fmoc-Asn(Dod)-OH
- (2S)-4-[bis(4-methoxyphenyl)methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-butanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-((bis(4-methoxyphenyl)methyl)amino)-4-oxobutanoic acid
CAS:Formula:C34H32N2O7Molecular weight:580.6271Fmoc-Asn(Dod)-OH
CAS:Fmoc-Asn(Dod)-OH is a pentafluorophenyl ester of the N-terminal tryptophan residue of an asparagine peptide. It is activated by alkylation with pentafluorophenyl bromoacetic acid, which attaches to the carbonyl carbon of the peptide backbone. The activated ester undergoes dehydration and amide formation in the presence of 4-methylbenzenesulfonyl chloride. This reagent can be used for efficient synthesis of peptides, such as proteins and enzymes.Formula:C34H32N2O7Purity:Min. 95%Molecular weight:580.63 g/mol


