
CAS 113544-17-5
:2-Phenyl-6-[(phenylmethyl)thio]-4H-thiopyran-4-one
Description:
2-Phenyl-6-[(phenylmethyl)thio]-4H-thiopyran-4-one is a heterocyclic organic compound characterized by its thiopyran ring structure, which incorporates sulfur into a six-membered ring. This compound features a phenyl group and a phenylmethylthio substituent, contributing to its aromatic properties and potential reactivity. The presence of the thiopyran moiety suggests that it may exhibit unique chemical behavior, including potential nucleophilic or electrophilic reactivity due to the sulfur atom. The compound's structure may also influence its solubility, stability, and interaction with biological systems, making it of interest in medicinal chemistry and material science. Additionally, the presence of multiple aromatic rings may enhance its photophysical properties, potentially making it useful in applications such as dyes or sensors. Overall, 2-Phenyl-6-[(phenylmethyl)thio]-4H-thiopyran-4-one represents a complex organic molecule with diverse potential applications based on its structural characteristics.
Formula:C18H14OS2
InChI:InChI=1S/C18H14OS2/c19-16-11-17(15-9-5-2-6-10-15)21-18(12-16)20-13-14-7-3-1-4-8-14/h1-12H,13H2
InChI key:InChIKey=QOVORVYWQXNVBY-UHFFFAOYSA-N
SMILES:S(CC1=CC=CC=C1)C=2SC(=CC(=O)C2)C3=CC=CC=C3
Synonyms:- 4H-Thiopyran-4-one, 2-phenyl-6-[(phenylmethyl)thio]-
- 2-(Benzylthio)-6-phenyl-4H-thiopyran-4-one
- 2-Phenyl-6-[(phenylmethyl)thio]-4H-thiopyran-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
