CAS 113546-44-4
:N-Chloro-N′-phenylurea
Description:
N-Chloro-N′-phenylurea is an organic compound characterized by its urea structure, where a chlorine atom is substituted at the nitrogen position adjacent to the phenyl group. This compound typically appears as a white to off-white solid and is known for its role as a herbicide and plant growth regulator. It exhibits moderate solubility in organic solvents and limited solubility in water, which influences its application in agricultural practices. The presence of the chloro group enhances its reactivity, making it effective in various chemical reactions. N-Chloro-N′-phenylurea is also notable for its potential environmental impact, necessitating careful handling and application to minimize ecological risks. Its synthesis generally involves the chlorination of phenylurea derivatives, and it is important to consider safety measures due to its potential toxicity. Overall, N-Chloro-N′-phenylurea is a compound of interest in both agricultural and chemical research contexts, with ongoing studies to better understand its properties and applications.
Formula:C7H7ClN2O
InChI:InChI=1S/C7H7ClN2O/c8-10-7(11)9-6-4-2-1-3-5-6/h1-5H,(H2,9,10,11)
InChI key:InChIKey=ULYSMQORPOQZCP-UHFFFAOYSA-N
SMILES:N(C(NCl)=O)C1=CC=CC=C1
Synonyms:- Urea, N-chloro-N′-phenyl-
- N-Chloro-N′-phenylurea
- 3-Chloro-1-phenylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
