CAS 113548-97-3
:5'deoxy-4',5-difluorouridine
Description:
5'-Deoxy-4',5-difluorouridine is a nucleoside analog characterized by the presence of fluorine substituents at the 4' and 5' positions of the ribose sugar moiety. This compound is derived from uridine, where the hydroxyl group at the 5' position is replaced by a deoxy group, and the 4' and 5' positions are modified with fluorine atoms. The introduction of fluorine enhances the compound's stability and can influence its biological activity, making it of interest in medicinal chemistry, particularly in antiviral and anticancer research. The structural modifications can affect the nucleoside's ability to interact with nucleic acids and enzymes, potentially leading to altered metabolic pathways. As a nucleoside analog, it may interfere with nucleic acid synthesis, thereby exhibiting therapeutic potential. Its CAS number, 113548-97-3, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, 5'-deoxy-4',5-difluorouridine represents a significant area of research in the development of novel therapeutic agents.
Formula:C9H10F2N2O5
InChI:InChI=1/C9H10F2N2O5/c1-9(11)5(15)4(14)7(18-9)13-2-3(10)6(16)12-8(13)17/h2,4-5,7,14-15H,1H3,(H,12,16,17)
SMILES:CC1(C(C(C(n2cc(c(nc2=O)O)F)O1)O)O)F
Synonyms:- 4'-F-5'-Dfurd
- 5'-Deoxy-5-fluoro-4'-C-fluorouridine
- Uridine, 5'-deoxy-5-fluoro-4'-C-fluoro-
- 5-fluoro-1-(5-fluoro-3,4-dihydroxy-5-methyltetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione (non-preferred name)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
