CAS 113557-95-2
:Magnoloside A
Description:
Magnoloside A, with the CAS number 113557-95-2, is a natural compound primarily derived from the bark of the Magnolia tree. It belongs to the class of glycosides, which are characterized by the presence of a sugar moiety attached to a non-sugar component, often contributing to its biological activity. This compound exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential neuroprotective effects, making it of interest in medicinal chemistry and pharmacology. Magnoloside A is known for its ability to modulate certain signaling pathways, which may contribute to its therapeutic potential. Additionally, it has been studied for its role in traditional medicine, particularly in Asian cultures, where extracts from Magnolia species have been used for their health benefits. The compound's stability, solubility, and reactivity can vary depending on environmental conditions, influencing its application in both research and potential therapeutic contexts. Further studies are ongoing to fully elucidate its mechanisms of action and potential uses in modern medicine.
Formula:C29H36O15
InChI:InChI=1S/C29H36O15/c1-13-22(36)24(38)25(39)28(41-13)44-27-26(43-21(35)7-4-14-2-5-16(31)18(33)10-14)23(37)20(12-30)42-29(27)40-9-8-15-3-6-17(32)19(34)11-15/h2-7,10-11,13,20,22-34,36-39H,8-9,12H2,1H3
InChI key:InChIKey=QLZWUGOYBODRLF-UHFFFAOYSA-N
SMILES:O(C1C(OC(C=CC2=CC(O)=C(O)C=C2)=O)C(O)C(CO)OC1OCCC3=CC(O)=C(O)C=C3)C4C(O)C(O)C(O)C(C)O4
Synonyms:- Magnoloside A
- b-D-Allopyranoside, 2-(3,4-dihydroxyphenyl)ethyl2-O-(6-deoxy-a-L-mannopyranosyl)-,3-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- β-<span class="text-smallcaps">D</smallcap>-Allopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 2-O-(6-deoxy-α-<smallcap>L</span>-mannopyranosyl)-, 3-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- β-<span class="text-smallcaps">D</smallcap>-Allopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 2-O-(6-deoxy-α-<smallcap>L</span>-mannopyranosyl)-, 3-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- β-D-Allopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 2-O-(6-deoxy-α-L-mannopyranosyl)-, 3-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- β-D-Allopyranoside, 2-(3,4-dihydroxyphenyl)ethyl 2-O-(6-deoxy-α-L-mannopyranosyl)-, 3-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Magnoloside A
CAS:Magnoloside A has potent antifungal activities against various Cryptococcus strains with minimum inhibitory concentration values ranging from 1.0 to 4.0 ug/ml.Formula:C29H36O15Purity:98.98%Color and Shape:SolidMolecular weight:624.59Ref: TM-TN1906
1mg87.00€2mg111.00€5mg180.00€10mg265.00€25mg447.00€50mg650.00€100mg888.00€1mL*10mM (DMSO)279.00€Magnoloside A
CAS:Magnoloside A is a bioactive compound, which is a natural product derived from the bark of the Magnolia plant. This compound is part of a group of phenolic glycosides that is extracted using advanced phytochemical techniques. Its mode of action primarily involves the inhibition of pro-inflammatory cytokines and modulation of various signaling pathways involved in inflammation and oxidative stress.
Formula:C29H36O15Purity:Min. 95%Molecular weight:624.6 g/mol



