
CAS 113558-10-4
:Ikarisoside B
Description:
Ikarisoside B is a natural compound classified as a glycoside, specifically derived from the plant species Ikarisoma. It is known for its potential pharmacological properties, including anti-inflammatory and antioxidant activities. The molecular structure of Ikarisoside B features a sugar moiety attached to a non-sugar component, which is typical of glycosides, influencing its solubility and biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential therapeutic applications, particularly in traditional medicine. Research has indicated that Ikarisoside B may exhibit protective effects against oxidative stress and could play a role in modulating various biological pathways. Its CAS number, 113558-10-4, serves as a unique identifier for this substance in chemical databases, facilitating its study and application in research. As with many natural products, further investigation is necessary to fully elucidate its mechanisms of action and potential benefits in health and disease.
Formula:C32H38O15
InChI:InChI=1S/C32H38O15/c1-12(2)4-9-16-17(35)10-18(36)20-23(39)29(27(45-28(16)20)14-5-7-15(34)8-6-14)46-32-30(25(41)21(37)13(3)43-32)47-31-26(42)24(40)22(38)19(11-33)44-31/h4-8,10,13,19,21-22,24-26,30-38,40-42H,9,11H2,1-3H3/t13-,19+,21-,22+,24-,25+,26+,30+,31-,32-/m0/s1
InChI key:InChIKey=FWINXQRXURMYOG-RTXMGSRZSA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2CC=C(C)C)C3=CC=C(O)C=C3)[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@H](O)[C@@H](O)[C@H](C)O4
Synonyms:- 3-[(6-Deoxy-2-O-β-D-glucopyranosyl-α-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-[(6-deoxy-2-O-β-D-glucopyranosyl-α-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-butenyl)-
- 4H-1-Benzopyran-4-one, 3-[(6-deoxy-2-O-β-D-glucopyranosyl-α-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-
- Icarisoside B
- Ikarisoside B
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4H-1-Benzopyran-4-one, 3-[(6-deoxy-2-O-β-D-glucopyranosyl-α-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-
CAS:Formula:C32H38O15Molecular weight:662.6351Ikarisoside B
CAS:Ikarisoside B is a useful organic compound for research related to life sciences. The catalog number is T126358 and the CAS number is 113558-10-4.Formula:C32H38O15Color and Shape:SolidMolecular weight:662.641

