CAS 113558-89-7
:N-[4-[[1-[2-(6-METHYL-2-PYRIDINYL)ETHYL]-4-PIPERIDINYL]CARBONYL]PHENYL]METHANESULFONAMIDE DIHYDROCHLORIDE
Description:
N-[4-[[1-[2-(6-Methyl-2-pyridinyl)ethyl]-4-piperidinyl]carbonyl]phenyl]methanesulfonamide dihydrochloride, with CAS number 113558-89-7, is a chemical compound characterized by its complex structure, which includes a sulfonamide group, a piperidine ring, and a pyridine moiety. This compound is typically a white to off-white solid and is soluble in water, which is a common trait for many sulfonamide derivatives. It exhibits properties that may include potential pharmacological activity, often investigated in the context of medicinal chemistry. The presence of multiple functional groups suggests that it may engage in various chemical interactions, making it of interest in drug development. Its dihydrochloride form indicates that it is a salt, which can enhance its stability and solubility in biological systems. As with many compounds of this nature, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific biological activities and therapeutic potential.
Formula:C21H27N3O3S
InChI:InChI=1S/C21H27N3O3S/c1-16-4-3-5-19(22-16)12-15-24-13-10-18(11-14-24)21(25)17-6-8-20(9-7-17)23-28(2,26)27/h3-9,18,23H,10-15H2,1-2H3
InChI key:InChIKey=SRUISGSHWFJION-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(NS(C)(=O)=O)C=C1)C2CCN(CCC=3N=C(C)C=CC3)CC2
Synonyms:- 4'-[[1-[2-(6-Methyl-2-Pyridinyl)Ethyl]-4-Piperidinyl]Carbonyl] Methanesulfonanilide, 2Hcl
- E-4031
- E-4031 Dihydrochloride
- Methanesulfonamide, N-[4-[[1-[2-(6-methyl-2-pyridinyl)ethyl]-4-piperidinyl]carbonyl]phenyl]-
- N-[4-({1-[2-(6-methylpyridin-2-yl)ethyl]piperidin-4-yl}carbonyl)phenyl]methanesulfonamide
- N-[4-[[1-[2-(6-Methyl-2-pyridinyl)ethyl]-4-piperidinyl]carbonyl]phenyl]methanesulfonamide
- N-[4-[[1-[2-(6-METHYL-2-PYRIDINYL)ETHYL]-4-PIPERIDINYL]CARBONYL]PHENYL]METHANESULFONAMIDE DIHYDROCHLORIDE
- E-4031 (free base)
- N-[4-[1-[2-(6-methylpyridin-2-yl)ethyl]piperidine-4-carbonyl]phenyl]methanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.