CAS 113571-15-6
:4,6-dibromo-2,3-dichloroaniline
Description:
4,6-Dibromo-2,3-dichloroaniline is an organic compound characterized by the presence of multiple halogen substituents on an aniline structure. It features two bromine atoms located at the 4 and 6 positions and two chlorine atoms at the 2 and 3 positions of the benzene ring, which is attached to an amino group (-NH2). This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and agrochemicals, due to the reactivity of the halogen substituents. The presence of multiple halogens can influence its chemical behavior, including its solubility in organic solvents and its reactivity in substitution reactions. Additionally, the compound may pose environmental and health risks, necessitating careful handling and disposal. As with many halogenated compounds, it is important to consider its potential toxicity and environmental impact during use and disposal.
Formula:C6H3Br2Cl2N
InChI:InChI=1/C6H3Br2Cl2N/c7-2-1-3(8)6(11)5(10)4(2)9/h1H,11H2
SMILES:c1c(c(c(c(c1Br)N)Cl)Cl)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenamine, 4,6-dibromo-2,3-dichloro-
CAS:Formula:C6H3Br2Cl2NPurity:%Color and Shape:SolidMolecular weight:319.80874,6-Dibromo-2,3-dichloroaniline
CAS:4,6-Dibromo-2,3-dichloroanilineFormula:C6H3Br2Cl2NPurity:≥95%Color and Shape: faint brown solidMolecular weight:319.81g/mol4,6-Dibromo-2,3-dichloroaniline
CAS:Formula:C6H3Br2Cl2NPurity:97.0%Color and Shape:SolidMolecular weight:319.814,6-Dibromo-2,3-dichloroaniline
CAS:Controlled Product<p>Applications 4,6-Dibromo-2,3-dichloroaniline is a bromination product of dichloro-substituted aniline. 4,6-Dibromo-2,3-dichloroaniline is used in the preparation of benzothiazoles.<br>References Gruzdev, I.V. et al.: Rus. J. Appl. Chem., 84, 1748 (2011); Paramasivam, R.: Ind. J. Chem. Sec. B Org. Med. Incl. Med. Chem., 26B, 930 (1987);<br></p>Formula:C6H3Br2Cl2NColor and Shape:NeatMolecular weight:319.81



