CAS 113571-16-7
:N-(4-Bromo-2,3-dichlorophenyl)acetamide
Description:
N-(4-Bromo-2,3-dichlorophenyl)acetamide is a chemical compound characterized by its specific functional groups and halogenated aromatic structure. It features an acetamide group attached to a phenyl ring that is substituted with bromine and chlorine atoms, which contribute to its unique reactivity and properties. The presence of these halogens typically enhances the compound's biological activity and may influence its solubility and stability in various solvents. This compound is often studied in the context of medicinal chemistry and may exhibit potential pharmacological effects due to its structural characteristics. Its molecular formula reflects the presence of carbon, hydrogen, bromine, and chlorine, indicating a relatively complex structure. The compound's CAS number, 113571-16-7, serves as a unique identifier in chemical databases, facilitating research and regulatory compliance. As with many halogenated compounds, it is essential to handle N-(4-Bromo-2,3-dichlorophenyl)acetamide with care, considering potential environmental and health impacts associated with halogenated organic substances.
Formula:C8H6BrCl2NO
InChI:InChI=1S/C8H6BrCl2NO/c1-4(13)12-6-3-2-5(9)7(10)8(6)11/h2-3H,1H3,(H,12,13)
InChI key:InChIKey=UOACBCIFRYIBLM-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(Cl)C(Cl)=C(Br)C=C1
Synonyms:- N-(4-Bromo-2,3-dichlorophenyl)acetamide
- Acetamide, N-(4-bromo-2,3-dichlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.