CAS 113589-54-1
:3-Ethoxy-4,5-dimethyl-2-thiophenecarboxylic acid
Description:
3-Ethoxy-4,5-dimethyl-2-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features an ethoxy group (-OCH2CH3) and two methyl groups (-CH3) attached to the thiophene ring, contributing to its unique chemical properties. The carboxylic acid functional group (-COOH) at the 2-position of the thiophene ring imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of the ethoxy and methyl substituents can influence the compound's solubility, reactivity, and overall stability. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C9H12O3S
InChI:InChI=1S/C9H12O3S/c1-4-12-7-5(2)6(3)13-8(7)9(10)11/h4H2,1-3H3,(H,10,11)
InChI key:InChIKey=KUVTWKMFGSVQBJ-UHFFFAOYSA-N
SMILES:O(CC)C1=C(C(O)=O)SC(C)=C1C
Synonyms:- 3-Ethoxy-4,5-dimethyl-2-thiophenecarboxylic acid
- 2-Thiophenecarboxylic acid, 3-ethoxy-4,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
