
CAS 1136-77-2
:4,6-Dimethyldibenzofuran
Description:
4,6-Dimethyldibenzofuran is an organic compound characterized by its fused dibenzofuran structure, which consists of two benzene rings connected by a furan ring. This compound features two methyl groups located at the 4 and 6 positions of the dibenzofuran framework, contributing to its unique chemical properties. It is typically a colorless to pale yellow solid with a relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. The presence of the methyl groups influences its reactivity and stability, making it less prone to oxidation compared to its non-methylated counterparts. 4,6-Dimethyldibenzofuran may exhibit interesting biological activities, which can be explored for potential applications in pharmaceuticals or agrochemicals. Its molecular structure allows for various substitution reactions, making it a valuable intermediate in organic synthesis. As with many organic compounds, handling should be done with care, considering potential health and environmental impacts.
Formula:C14H12O
InChI:InChI=1S/C14H12O/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)15-13(9)11/h3-8H,1-2H3
InChI key:InChIKey=PVBRAGJTHQZENQ-UHFFFAOYSA-N
SMILES:CC1=C2C(C=3C(O2)=C(C)C=CC3)=CC=C1
Synonyms:- 4,6-Dimethyldibenzofuran
- 1,8-Dimethyldiphenylene oxide
- 4,6-Dimethyldibenzo[b,d]furan
- Dibenzofuran, 4,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
