CAS 1136-88-5

2-[(5,6,7,8-Tetrahydro-4-quinazolinyl)thio]acetic acid

Description:

2-[(5,6,7,8-Tetrahydro-4-quinazolinyl)thio]acetic acid, with the CAS number 1136-88-5, is a chemical compound characterized by its unique structure that includes a quinazoline moiety and a thiol group. This compound typically exhibits properties associated with both acidic and thioether functionalities, making it potentially useful in various chemical reactions and applications. It is a solid at room temperature and is soluble in polar solvents, which is common for compounds containing carboxylic acid groups. The presence of the tetrahydroquinazoline structure may impart biological activity, suggesting potential pharmacological applications. Additionally, the compound's thioether linkage can enhance its reactivity and stability in certain chemical environments. Overall, 2-[(5,6,7,8-Tetrahydro-4-quinazolinyl)thio]acetic acid represents a versatile compound of interest in medicinal chemistry and organic synthesis, although specific applications and biological activities would require further investigation.

Formula: C₁₀H₁₂N₂O₂S

InChI: InChI=1S/C10H12N2O2S/c13-9(14)5-15-10-7-3-1-2-4-8(7)11-6-12-10/h6H,1-5H2,(H,13,14)

InChI key: InChIKey=ZROQZHUXZJENQN-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C1=C2C(=NC=N1)CCCC2

Synonyms:

• 2-[(5,6,7,8-Tetrahydro-4-quinazolinyl)thio]acetic acid
• Acetic acid, 2-[(5,6,7,8-tetrahydro-4-quinazolinyl)thio]-
• Acetic acid, [(5,6,7,8-tetrahydro-4-quinazolinyl)thio]-
• 2-(5,6,7,8-Tetrahydroquinazolin-4-ylsulfanyl)acetic acid