CAS 1136-89-6
:1-Naphthyl phosphate
Description:
1-Naphthyl phosphate, with the CAS number 1136-89-6, is an organic compound that serves as a phosphate ester. It is characterized by the presence of a naphthalene ring, which is a polycyclic aromatic hydrocarbon, bonded to a phosphate group. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents but has limited solubility in water. 1-Naphthyl phosphate is often used in biochemical research as a substrate for various enzymes, particularly in studies involving phosphatases, which catalyze the removal of phosphate groups from molecules. Its reactivity is influenced by the presence of the naphthyl group, which can participate in various chemical reactions, including electrophilic substitutions. Additionally, it is important to handle this compound with care, as phosphate esters can exhibit toxicity and environmental persistence. Overall, 1-naphthyl phosphate is a valuable compound in both synthetic and analytical chemistry contexts.
Formula:C10H9O4P
InChI:InChI=1S/C10H9O4P/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H2,11,12,13)
InChI key:InChIKey=YNXICDMQCQPQEW-UHFFFAOYSA-N
SMILES:O(P(=O)(O)O)C=1C2=C(C=CC1)C=CC=C2
Synonyms:- α-Naphthyl phosphate
- 1-Naphthol, dihydrogen phosphate
- 1-Naphthyl phosphate
- 1-Naphthalenol, 1-(dihydrogen phosphate)
- 1-Naphthalenol, dihydrogen phosphate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Naphthalenol, 1-(dihydrogen phosphate)
CAS:Formula:C10H7O4PPurity:99%Color and Shape:SolidMolecular weight:222.1339Naphthalen-1-yl dihydrogen phosphate
CAS:Naphthalen-1-yl dihydrogen phosphatePurity:99%Molecular weight:224.15g/mol1-Naphthyl phosphate
CAS:1-Naphthyl phosphate is a diazonium salt that reacts with p-nitrophenyl phosphate to form an orange color. It is used in the detection of human serum proteins and can be used as an analytical chemistry model system for phosphatase activity. 1-Naphthyl phosphate is also used as a substrate for enzyme kinetics, which enables the determination of kinetic parameters such as Km, Vmax, and Kcat. This compound can be used to produce a monoclonal antibody against mouse monoclonal antibodies by using hybridization techniques.
Formula:C10H9O4PPurity:Min. 95%Color and Shape:PowderMolecular weight:224.15 g/mol




