CymitQuimica logo

CAS 113600-21-8

:

12-fluoroindeno[1,2,3-cd]pyrene

Description:
12-Fluoroindeno[1,2,3-cd]pyrene is a polycyclic aromatic hydrocarbon (PAH) characterized by its complex fused ring structure, which includes both indeno and pyrene moieties. The presence of a fluorine atom at the 12-position significantly influences its chemical properties, including its electronic structure and reactivity. This compound is typically studied for its potential applications in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaics, due to its favorable charge transport properties. Additionally, like many PAHs, it may exhibit fluorescence, making it of interest in photonic applications. Its environmental persistence and potential toxicity are also important considerations, as PAHs are known to be hazardous pollutants. The compound's synthesis and characterization involve advanced organic chemistry techniques, and it is often analyzed using methods such as spectroscopy and chromatography to determine its purity and structural integrity. Overall, 12-fluoroindeno[1,2,3-cd]pyrene represents a significant subject of study in both materials science and environmental chemistry.
Formula:C22H11F
InChI:InChI=1/C22H11F/c23-19-11-18-15-7-2-1-6-14(15)17-10-13-5-3-4-12-8-9-16(19)22(20(12)13)21(17)18/h1-11H
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.