CAS 113611-68-0
:TNRNFLRFamide
Description:
TNRNFLRFamide, also known by its CAS number 113611-68-0, is a peptide that belongs to the class of neuropeptides. It is characterized by a specific sequence of amino acids, which contributes to its biological activity. This peptide is known to play a role in various physiological processes, including modulation of pain and neuroendocrine functions. TNRNFLRFamide is often studied for its potential implications in neurobiology and pharmacology, particularly in relation to its receptor interactions and signaling pathways. Its structure typically includes a C-terminal amide group, which is common in many biologically active peptides, enhancing stability and receptor binding. The study of TNRNFLRFamide and similar peptides is significant for understanding their roles in cellular communication and potential therapeutic applications. As with many peptides, its synthesis can be achieved through solid-phase peptide synthesis techniques, allowing for the exploration of its structure-activity relationships in research settings.
Formula:C48H75N17O11
InChI:InChI=1/C48H75N17O11/c1-25(2)20-32(42(72)59-29(16-10-18-57-47(53)54)40(70)61-31(39(52)69)21-27-12-6-4-7-13-27)62-43(73)33(22-28-14-8-5-9-15-28)63-45(75)34(23-36(49)67)64-41(71)30(17-11-19-58-48(55)56)60-44(74)35(24-37(50)68)65-46(76)38(51)26(3)66/h4-9,12-15,25-26,29-35,38,66H,10-11,16-24,51H2,1-3H3,(H2,49,67)(H2,50,68)(H2,52,69)(H,59,72)(H,60,74)(H,61,70)(H,62,73)(H,63,75)(H,64,71)(H,65,76)(H4,53,54,57)(H4,55,56,58)/t26-,29+,30+,31+,32+,33+,34+,35+,38+/m1/s1
Synonyms:- F1 Peptide, lobster
- Lobster peptide F1
- Peptide F(1), lobster
- Thr-asn-arg-asn-phe-leu-arg-phe-NH2
- Threonyl-asparaginyl-arginyl-asparaginyl-phenylalanyl-leucyl-arginyl-phenylalaninamide
- L-Phenylalaninamide, L-threonyl-L-asparaginyl-L-arginyl-L-asparaginyl-L-phenylalanyl-L-leucyl-L-arginyl-
- L-threonyl-L-asparaginyl-N~5~-(diaminomethylidene)-L-ornithyl-L-asparaginyl-L-phenylalanyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-L-phenylalaninamide
- Tnrnflrfamide
- 9:PN:WO0114883 SEQID:10 claimed protein
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
L-Phenylalaninamide, L-threonyl-L-asparaginyl-L-arginyl-L-asparaginyl-L-phenylalanyl-L-leucyl-L-arginyl-
CAS:Formula:C48H75N17O11Molecular weight:1066.2164Tnrnflrfamide
CAS:Tnrnflrfamide is a SCP (small cardioactive peptide)-like peptide found in lobster neurons; exhibits FMRFamide-like immunoreactivity.Formula:C48H75N17O11Purity:98%Color and Shape:SolidMolecular weight:1066.22H-Thr-Asn-Arg-Asn-Phe-Leu-Arg-Phe-NH2
CAS:<p>H-Thr-Asn-Arg-Asn-Phe-Leu-Arg-Phe-NH2 is a peptide hormone that is encoded by the proctolin gene. It is found in the gastrointestinal tract and blood of mammals, and it has been shown to have physiological effects on the cardiovascular system. H-Thr-Asn-Arg-Asn-Phe-Leu-Arg-Phe NH2 has been shown to activate voltage gated sodium channels in cardiac tissue, enhancing cardiac function and reducing blood pressure. This peptide also has a role in cancer cell growth and neurosecretory activity.</p>Formula:C48H75N17O11Purity:Min. 95%Molecular weight:1,066.22 g/mol


