
CAS 113612-56-9
:Phosphonic acid, (2,3-dihydroxypropyl)-, bis(1-methylethyl) ester
Description:
Phosphonic acid, (2,3-dihydroxypropyl)-, bis(1-methylethyl) ester, commonly referred to as a phosphonate, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group and two isopropyl ester groups. This compound typically exhibits properties such as high solubility in polar solvents due to its hydroxyl groups, which can engage in hydrogen bonding. The presence of the phosphonic acid moiety imparts potential applications in agriculture as a herbicide or fungicide, as well as in various industrial processes. Its structure suggests that it may have a role in chelation or coordination with metal ions, which can be beneficial in certain chemical applications. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety and handling precautions are essential due to the potential toxicity associated with organophosphorus compounds. Overall, this substance is notable for its multifunctional characteristics, which can be leveraged in diverse chemical and industrial applications.
Formula:C9H21O5P
InChI:InChI=1S/C9H21O5P/c1-7(2)13-15(12,14-8(3)4)6-9(11)5-10/h7-11H,5-6H2,1-4H3
InChI key:InChIKey=LGSKXNQKTUSZQG-UHFFFAOYSA-N
SMILES:P(CC(CO)O)(OC(C)C)(OC(C)C)=O
Synonyms:- Phosphonic acid, (2,3-dihydroxypropyl)-, bis(1-methylethyl) ester
- 3-Di(propan-2-yloxy)phosphorylpropane-1,2-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phosphonic acid, (2,3-dihydroxypropyl)-, bis(1-methylethyl) ester (9CI)
CAS:Formula:C9H21O5PMolecular weight:240.2338
