CymitQuimica logo

CAS 113618-90-9

:

3-Acetyl-4-amino-3-pentenenitrile

Description:
3-Acetyl-4-amino-3-pentenenitrile, with the CAS number 113618-90-9, is an organic compound characterized by its unique functional groups, including an acetyl group, an amino group, and a nitrile group. This compound features a pentene backbone, which contributes to its unsaturation and potential reactivity. The presence of the nitrile group indicates that it may exhibit polar characteristics, influencing its solubility in various solvents. The amino group can participate in hydrogen bonding, enhancing its reactivity in organic synthesis and potential biological activity. The compound's structure suggests it may be involved in various chemical reactions, such as nucleophilic substitutions or additions, making it of interest in synthetic organic chemistry. Additionally, its derivatives may have applications in pharmaceuticals or agrochemicals, although specific applications would depend on further research into its biological properties and reactivity. Overall, 3-acetyl-4-amino-3-pentenenitrile is a versatile compound with potential utility in various chemical contexts.
Formula:C7H10N2O
InChI:InChI=1S/C7H10N2O/c1-5(9)7(3-4-8)6(2)10/h3,9H2,1-2H3
InChI key:InChIKey=HARIBJFEZOIBQX-UHFFFAOYSA-N
SMILES:C(CC#N)(=C(C)N)C(C)=O
Synonyms:
  • 3-Acetyl-4-amino-3-pentenenitrile
  • 3-Pentenenitrile, 3-acetyl-4-amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.