CAS 113629-51-9
:2-aminoethyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate
Description:
2-Aminoethyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate is a complex organic compound characterized by its dihydropyridine structure, which is a key feature in many biologically active molecules, particularly in pharmaceuticals. This compound contains multiple functional groups, including an amino group, a nitro group, and a carboxylate, which contribute to its reactivity and potential biological activity. The presence of the trifluoromethyl group enhances lipophilicity, potentially influencing its pharmacokinetic properties. The compound's structure suggests it may exhibit properties such as vasodilatory effects or calcium channel modulation, common to dihydropyridine derivatives. Additionally, the presence of methyl groups can affect steric hindrance and electronic properties, impacting its interaction with biological targets. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in medicinal chemistry and drug development.
Formula:C17H18F3N3O4
InChI:InChI=1/C17H18F3N3O4/c1-9-13(16(24)27-8-7-21)14(15(23(25)26)10(2)22-9)11-5-3-4-6-12(11)17(18,19)20/h3-6,14,22H,7-8,21H2,1-2H3
SMILES:CC1=C(C(c2ccccc2C(F)(F)F)C(=C(C)N1)N(=O)=O)C(=O)OCCN
Synonyms:- 3-Pyridinecarboxylic acid, 1,4-dihydro-2,6-dimethyl-5-nitro-4-(2-(trifluoromethyl)phenyl)-, 2-aminoethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Pyridinecarboxylic acid, 1,4-dihydro-2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-, 2-aminoethyl ester
CAS:Formula:C17H18F3N3O4Molecular weight:385.3377
